Wnt/β-catenin-IN-3 | MedChemExpress (MCE)
Wnt/β-catenin-IN-3 (compound 17) is a Wnt/β-catenin inhibitor with low micromolarGI50s against various cancer cells. Wnt/β-catenin-IN-3triggers G2/M cell cycle arrest though activation of p53-p21 pathway as well as intrinsic and extrinsic apoptotic death of colon cancer cells[1].
| Trivial name | Wnt/β-catenin-IN-3 |
| Catalog Number | HY-158210 |
| Research Area | Cancer |
| CAS# | 1809413-98-6 |
| Purity | ≥98.0% |
| SMILES | COC1=CC=C(C=C1)C(NC2=CC(C3=CC(C4=C(C(OC)=C(C=C4O3)OC)OC)=O)=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/wnt-β-catenin-in-3.html |