Jaceosidin 25mg
Jaceosidin is a pharmacologically active flavone derived from Artemisia argyi, inhibits phorbol-ester-induced upregulation of COX-2 and MMP-9 by blocking phosphorylation of ERK-1 and -2 in cultured human mammary epithelial cells.
| Trivial name | Jaceosidin 25mg |
| Catalog Number | A12080-25 |
| Alternative Name(s) | 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxychromen-4-one |
| Molecular Formula | C17H14O7 |
| CAS# | 18085-97-7 |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC)O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/jaceosidin.html |