(-)-Perillaldehyde
Perillaldehyde is a natural compound in the herb perilla and in the peel of citrus fruits. It is used in perfumery and has a mint-like cinnamon odor.
| Trivial name | perilla aldehyde;p-mentha-1,8-dien-7-al |
| Catalog Number | CSN27276 |
| Alternative Name(s) | perilla aldehyde;p-mentha-1,8-dien-7-al |
| Research Area | / |
| Molecular Formula | C10H14O |
| CAS# | 18031-40-8 |
| Purity | ≥90% |
| SMILES | C=C([C@@H]1CC=C(C=O)CC1)C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/(-)-perillaldehyde.html |