Diethyl 2,5-Dibromoterephthalate
Diethyl 2,5-Dibromoterephthalate is a donor used in solar cells. It is synthesized by reacting pyrrole with triamine to form a diethyl ester. This product is an anti-aging agent that inhibits the production of reactive oxygen species (ROS) and blocks the formation of advanced glycation end products (AGEs). Diethyl 2,5-Dibromoterephthalate has been shown to be effective as an optical acceptor in solar cells and can be used in perovskite solar cells.
| Catalog Number | ABA-064 |
| CAS# | 18013-97-3 |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Br)C(=O)OCC)Br |
| Size | Inquiry |
| Supplier Page | https://www.agingclocks.com/diethyl-25-dibromoterephthalate-item-1934.html |
