Bupivacaine HCl 10mM * 1mL in DMSO
Bupivacaine is a more potent inhibitor of cAMP production than are chemically related local anesthetics that are less prone to produce cardiovascular toxicity.
| Trivial name | Bupivacaine HCl 10mM * 1mL in DMSO |
| Catalog Number | A10168-10mM-D |
| Alternative Name(s) | 1-Butyl-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide hydrochloride |
| Molecular Formula | C18H28N2O.HCl |
| CAS# | 18010-40-7 |
| SMILES | CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bupivacaine-hydrochloride.html |
