7-Chlorokynurenic acid
7-Chlorokynurenic acid is an antagonist of NMDA receptor acting at the glycine site. It can also act as competitive inhibitor of L-glutamate transport into synaptic vesicles.
| Trivial name | / |
| Catalog Number | CSN25808 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C10H6ClNO3 |
| CAS# | 18000-24-3 |
| Purity | ≥98% |
| SMILES | O=C(C1=NC2=CC(Cl)=CC=C2C(O)=C1)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/7-chloro-4-hydroxyquinoline-2-carboxylic-acid.html |