Lamotrigine 3,3-Dimer
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-10490 |
| Alternative Name(s) | 3-[[5-Amino-6-(2,3ino]methylamino]-5-amino-6-(2,32,4-triazine;N3,N3'-methylenebis(6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine). |
| Research Area | Lamotrigine 3,3-Dimer is a dimer impurity of the anticonvulsant Lamotrigine |
| Molecular Formula | C19H14Cl4N10 |
| CAS# | 1797983-48-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C2=NN=C(NCNC3=NN=C(C(C=CC=C4Cl)=C4Cl)C(N)=N3)N=C2N)C=CC=C1Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10490.html |
| Additional Information | NULL |