Vilazodone-D8 TFA salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16705 |
| Alternative Name(s) | 5-{4-[4-(5-cyano-1H-indol-3-yl)butyl](2,2,3,3,5,5,6,6-D8)piperazin-1-yl}-1-benzofuran-2-carboxamide; trifluoroacetic acid |
| Research Area | Labeled Vilazodone, intended for use as an internal standard for the quantification of Vilazodone by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H20D8F3N5O4 |
| CAS# | 1794789-93-7 (Free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N#CC1=CC=C2C(C(CCCCN3C([2H])([2H])C([2H])([2H])N(C4=CC=C5C(C=C(C(N)=O)O5)=C4)C([2H])([2H])C3([2H])[2H])=CN2)=C1.FC(F)(C(O)=O)F |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16705.html |
| Additional Information | NULL |