Caspofungin diacetate (Standard) | MedChemExpress (MCE)
Caspofungin (diacetate) (Standard) is the analytical standard of Caspofungin (diacetate). This product is intended for research and analytical applications. Caspofungin (MK-0991) diacetate is a potent antifungal agent. Caspofungin diacetate inhibits the synthesis of the fungal cell wall component β-(l,3)-D-glucan[1][2].
| Trivial name | Caspofungin diacetate (Standard) |
| Catalog Number | HY-17006R |
| Alternative Name(s) | MK-0991 diacetate (Standard); L-743872 diacetate (Standard) |
| Research Area | Infection; Cancer |
| CAS# | 179463-17-3 |
| Purity | ≥98.0% |
| SMILES | O=C([C@](NC([C@](NC([C@@](C[C@H]1O)([H])N(C1)C2=O)=O)([H])[C@H](O)[C@H](C(C=C3)=CC=C3O)O)=O)([H])[C@H](O)CCN)N(CC[C@@H]4O)[C@]4([H])C(N[C@@H]([C@@H](C[C@@H](C(N[C@@]2([H])[C@H](O)C)=O)NC(CCCCCCCC[C@@H](C)C[C@@H](C)CC)=O)O)NCCN)=O.OC(C)=O.OC(C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/caspofungin-diacetate-standard.html |