Caspofungin Acetate 10mM * 1mL in DMSO
Caspofungin is a semi-synthetic analogue of pneumocandin B0 with improved water solubility, a significant limitation in the development of the echinocandin class as pharmaceuticals.
Trivial name | Caspofungin Acetate 10mM * 1mL in DMSO |
Catalog Number | A11364-10mM-D |
Alternative Name(s) | 1-[(4R,5S)-5-[(2-Aminoethyl)amino]-N2-(10,12-dimethyl-1-oxotetradecyl)-4-hydroxy-L-ornithine]-5-[(3R)-3-hydroxy-L-ornithine]-pneumocandin B0 |
Molecular Formula | N/A |
CAS# | 179463-17-3 |
SMILES | CCC(C)CC(C)CCCCCCCCC(=O)N[C@H]1C[C@H]([C@H](NC(=O)[C@@H]2[C@H](CCN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@@H](NC1=O)[C@@H](C)O)O)[C@H]([C@@H](C4=CC=C(C=C4)O)O)O)[C@@H](CCN)O)O)NCCN)O.CC(=O)O.CC(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/caspofungin-acetate.html |