PD 151746 10mM * 1mL in DMSO
PD 151746 is a selective, cell-permeable calpain inhibitor with Ki of 0.26 ??M for ??-Calpain, about 20-fold selectivity over m-calpain.
| Trivial name | PD 151746 10mM * 1mL in DMSO |
| Catalog Number | A14245-10mM-D |
| Alternative Name(s) | 3-(5-fluoro-1H-indol-3-yl)-2-mercapto-2-propenoic acid |
| Molecular Formula | C11H8FNO2S |
| CAS# | 179461-52-0 |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)/C=C(/C(=O)O)S |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pd-151746.html |
