PD 089828
An inhibitor of EGFR, PDGFß, FGF, and c-Src
| Catalog Number | 21435 |
| Alternative Name(s) | EGF/FGF/PDGF Receptor Tyrosine Kinase Inhibitor |
| Research Area | Product Type|Biochemicals|Kinase Inhibitors|EGFR/ErbB/HER Family||Product Type|Biochemicals|Kinase Inhibitors|FGFR Family||Product Type|Biochemicals|Kinase Inhibitors|PDGFR Family||Product Type|Biochemicals|Kinase Inhibitors|SRC Family||Product Type|Biochemicals|Small Molecule Inhibitors|Kinases||Research Area|Cell Biology|Cell Signaling|Growth Factor Receptors |
| Molecular Formula | C18H18Cl2N6O |
| CAS# | 179343-17-0 |
| Purity | ≥98% |
| Inchi | InChI=1S/C18H18Cl2N6O/c1-18(2,3)26-17(27)25-15-10(13-11(19)5-4-6-12(13)20)7-9-8-22-16(21)24-14(9)23-15/h4-8H,1-3H3,(H4,21,22,23,24,25,26,27) |
| Inchi Key | RRWSNCZYJCOEFX-UHFFFAOYSA-N |
| SMILES | NC(N=C1)=NC(C1=C2)=NC(NC(NC(C)(C)C)=O)=C2C3=C(Cl)C=CC=C3Cl |
| Size | 5 mg |
| Supplier Page | https://www.caymanchem.com/product/21435 |