Bortezomib
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00482 |
| Alternative Name(s) | [(1R)-3-methyl-1-[(2S)-3-phenyl-2-(pyrazin-2-ylformamido)propanamido]butyl]boronic acid |
| Research Area | Bortezomib is the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. |
| Molecular Formula | C19H25BN4O4 |
| CAS# | 179324-69-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N[C@H](B(O)O)CC(C)C)[C@@H](NC(C1=NC=CN=C1)=O)CC2=CC=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00482.html |
| Additional Information | NULL |