C-DIM12
C-DIM12 induced expression of Nurr1-regulated genes. C-DIM12 increased expression of transfected human Nurr1, induced Nurr1 protein expression in primary dopaminergic neurons and enhanced neuronal survival from exposure to 6-OHDA.
| Catalog Number | T3106 |
| Research Area | Apoptosis|||Others |
| Molecular Formula | C23H17ClN2 |
| CAS# | 178946-89-9 |
| Purity | 99.15% |
| SMILES | Clc1ccc(C(c2c[nH]c3c2cccc3)c2c[nH]c3c2cccc3)cc1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/C-DIM12 |
| Additional Information | https://www.targetmol.com/datasheet/T3106 |
