Hoechst 33342 analog 50mg
Hoechst 33342 analog is a nalog of Hoechst stains, which are part of a family of blue fluorescent dyes used to stain DNA.
| Trivial name | Hoechst 33342 analog 50mg |
| Catalog Number | A15113-50 |
| Alternative Name(s) | N, N-bis(2-chloroethyl)-4-[3-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]propyl]aniline |
| Molecular Formula | C32H37Cl2N7 |
| CAS# | 178481-68-0 |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)CCCC6=CC=C(C=C6)N(CCCl)CCCl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/hoechst-33342-analog.html |
