MCTR3 | MedChemExpress (MCE)
MCTR3 is a potent cytokine of pro-resolving mediating maresin conjugates in tissue regeneration (MCTR), which reduces the inflammatory response and promotes the tissue regeneration. MCTR3 exhibits potency in ameliorating LPS-induced acute lung injury and arthritis[1][2][3].
| Trivial name | MCTR3 |
| Catalog Number | HY-125516 |
| Research Area | Inflammation/Immunology; Others |
| CAS# | 1784701-63-8 |
| Purity | ≥98.0% |
| SMILES | O[C@H]([C@@H](/C=C/C=C/C=C\C/C=C\CCC(O)=O)SC[C@@H](C(O)=O)N)C/C=C\C/C=C\CC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mctr3.html |