D-Aspartic acid
D-Aspartic acid (D-Asp, Aminosuccinic acid, asparagic acid, asparaginic acid) is an endogenous amino acid occurring in several tissues and cells of both invertebrates and vertebrates. It can regulate testosterone synthesis and may act on a stimulatory receptor (NMDA).
| Trivial name | Asp, Aminosuccinic acid, asparagic acid, asparaginic acid |
| Catalog Number | S5129 |
| Molecular Formula | C4H7NO4 |
| CAS# | 1783-96-6 |
| Inchi | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 |
| Inchi Key | CKLJMWTZIZZHCS-UWTATZPHSA-N |
| SMILES | C(C(C(=O)O)N)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/d-aspartic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/d-aspartic-acid-chemical-structure-s5129.gif |