γ-CEHC | MedChemExpress (MCE)
γ-CEHC is a γ-tocopherol (HY-N7148) metabolite. γ-CEHC is mainly excreted into the urine rather than into the bile. γ-CEHC is present in conjugated form in human urine, mainly as glucuronide[1].
| Trivial name | γ-CEHC |
| Catalog Number | HY-113095 |
| Research Area | Others |
| CAS# | 178167-75-4 |
| Purity | ≥98.00% |
| SMILES | O=C(O)CCC1(C)CCC2=CC(O)=C(C)C(C)=C2O1 |
| PubChem Chemical Structure ID | 133098 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/γ-cehc.html |