(±)-PPCC oxalate | MedChemExpress (MCE)
(±)-PPCC oxalate is a sigma-1 agonist that mainly interacts with sigma-1 receptors with Ki of 1.5 nM. (±)-PPCC oxalate has effective anti-amnesia effects in rats with mild or severe cognitive impairment, and can improve the cognitive abilities of rats[1].
| Trivial name | (±)-PPCC oxalate |
| Catalog Number | HY-111081C |
| Research Area | Neurological Disease |
| CAS# | 1781628-91-8 |
| Purity | ≥98.00% |
| SMILES | OC(C(O)=O)=O.COC([C@]1(C2=CC=C(C=C2)C)[C@@H](C1)CN3CCC(CC3)(C4=CC=CC=C4)O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-ppcc-oxalate.html |