Allopurinol sodium 10mM * 1mL in DMSO
Allopurinol is a structural isomer of hypoxanthine (a naturally occurring purine in the body) and is an inhibitor of the enzyme xanthine oxidase.
Trivial name | Allopurinol sodium 10mM * 1mL in DMSO |
Catalog Number | A10056-10mM-D |
Alternative Name(s) | 1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, monosodium salt |
Molecular Formula | C5H4N4NaO |
CAS# | 17795-21-0 |
SMILES | C1=NNC2=C1C(=NC=N2)[O-].[Na+] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/allopurinol-sodium.html |