Clonixin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10839 |
| Alternative Name(s) | 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid |
| Research Area | Clonixin is a non-steroidal anti-inflammatory drug. It also has analgesic, antipyretic, and platelet-inhibitory actions. The compound has been reported to block prostaglandin synthesis, and to block inward calcium currents. |
| Molecular Formula | C13H11ClN2O2 |
| CAS# | 17737-65-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=CC=C1Cl)NC(N=CC=C2)=C2C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10839.html |
| Additional Information | NULL |