Ambrisentan
Ambrisentan is an oral, once-daily endothelin receptor antagonist that is selective for the endothelin type A receptor (IC50s = 0.251, 0.316, 0.398, 251, and 630 nM for rat preparations of heart, bladder, kidney, lung, and cerebral cortex, respectively).
| Trivial name | LU-208075; BSF 208075 |
| Catalog Number | CSN10496 |
| Alternative Name(s) | LU-208075; BSF 208075 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C22H22N2O4 |
| CAS# | 177036-94-1 |
| Purity | ≥99% |
| SMILES | O=C(O)[C@@H](OC1=NC(C)=CC(C)=N1)C(C2=CC=CC=C2)(OC)C3=CC=CC=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ambrisentan.html |