Ambrisentan (BSF 208075) 10mM * 1mL in DMSO
Ambrisentan functions as an endothelin receptor antagonist, and is selective for the type A endothelin receptor (ETA).
| Trivial name | Ambrisentan (BSF 208075) 10mM * 1mL in DMSO |
| Catalog Number | A11291-10mM-D |
| Alternative Name(s) | (2S)-2-[(4,6-dimethylpyrimidin-2-yl)oxy]-3-methoxy- 3,3-diphenylpropanoic acid |
| Molecular Formula | C22H22N2O4 |
| CAS# | 177036-94-1 |
| SMILES | CC1=CC(=NC(=N1)O[C@H](C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ambrisentan.html |