8-iso Prostaglandin F2β | MedChemExpress (MCE)
8-iso Prostaglandin F2β (8-iso PGF2β) is a biomarker for assessing oxidative stress, and its content in serum can indirectly reflect the level of oxidative stress[1].
| Trivial name | 8-iso Prostaglandin F2β |
| Catalog Number | HY-138244 |
| Alternative Name(s) | 8-iso PGF2β |
| Research Area | Inflammation/Immunology |
| CAS# | 177020-26-7 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@H]1[C@H]([C@@H](C[C@H]1O)O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/8-iso-prostaglandin-f2β.html |