CCT007093
PPM1D inhibitor Chromatin/Epigenetics|Protein Ser/Thr Phosphatases
| Catalog Number | B3274-25 |
| Research Area | Chromatin/Epigenetics|Protein Ser/Thr Phosphatases |
| Molecular Formula | C15H12OS2 |
| CAS# | 176957-55-4 |
| Purity | 99.83% |
| SMILES | C1CC(=CC2=CC=CS2)C(=O)C1=CC3=CC=CS3 |
| Size | 25mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3274 |
