Nicotiflorin
Nicotiflorin, a natural product isolated and purified from the herb of Carthamus tinctorius L., has protective effects on reducing memory dysfunction, energy metabolism failure and oxidative stress in multi-infarct dementia model rats.
| Trivial name | / |
| Catalog Number | CSN11244 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C27H30O15 |
| CAS# | 17650-84-9 |
| Purity | ≥98% |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)O)O)O)=C(C4=CC=C(O)C=C4)OC5=CC(O)=CC(O)=C15 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/nicotiflorin.html |