Metolazone 200mg
Metolazone and the other thiazide diuretics inhibit the function of the sodium-chloride symporter and prevent sodium and chloride, water as well, from leaving the lumen to enter the tubule cell.
Trivial name | Metolazone 200mg |
Catalog Number | A10584-200 |
Alternative Name(s) | 7-chloro-2-methyl-4-oxo-3-o-tolyl-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
Molecular Formula | C16H16ClN3O3S |
CAS# | 17560-51-9 |
SMILES | CC1NC2=CC(=C(C=C2C(=O)N1C3=CC=CC=C3C)S(=O)(=O)N)Cl |
Size | 200mg |
Supplier Page | http://www.adooq.com/metolazone.html |