RO 46-8443
RO 46-8443 is the first non-peptide endothelin ETB receptor selective antagonist. RO 46-8443 displays up to 2000-fold selectivity for ETB receptors both in terms of binding inhibitory potency and functional inhibition.
| Catalog Number | T3474 |
| Research Area | GPCR/G Protein |
| Molecular Formula | C31H35N3O8S |
| CAS# | 175556-12-4 |
| Purity | 98.50% |
| SMILES | c1(ccc(cc1)C(C)(C)C)S(=O)(=O)Nc1nc(nc(c1Oc1c(cccc1)OC)OC[C@@H](CO)O)c1ccc(cc1)OC |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/RO 46-8443 |
| Additional Information | https://www.targetmol.com/datasheet/T3474 |
