Voreloxin 25mg
Voreloxin is a small molecule and a naphthyridine analogue with antineoplastic activity. Vosaroxin intercalates into DNA in a site-specific manner and blocks the re-ligation process carried out by topoisomerase II during DNA replication
| Trivial name | Voreloxin 25mg |
| Catalog Number | A14158-25 |
| Alternative Name(s) | 7-((3S,4S)-3-methoxy-4-(methylamino)pyrrolidin-1-yl)-4-oxo-1-(thiazol-2-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| Molecular Formula | C18H19N5O4S |
| CAS# | 175414-77-4 |
| SMILES | CN[C@H]1CN(C[C@@H]1OC)C2=NC3=C(C=C2)C(=O)C(=CN3C4=NC=CS4)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/voreloxin.html |
