Voreloxin 10mM * 1mL in DMSO
Voreloxin is a small molecule and a naphthyridine analogue with antineoplastic activity. Vosaroxin intercalates into DNA in a site-specific manner and blocks the re-ligation process carried out by topoisomerase II during DNA replication
Trivial name | Voreloxin 10mM * 1mL in DMSO |
Catalog Number | A14158-10mM-D |
Alternative Name(s) | 7-((3S,4S)-3-methoxy-4-(methylamino)pyrrolidin-1-yl)-4-oxo-1-(thiazol-2-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
Molecular Formula | C₁₈H₁₉N₅O₄S |
CAS# | 175414-77-4 |
SMILES | CN[C@H]1CN(C[C@@H]1OC)C2=NC3=C(C=C2)C(=O)C(=CN3C4=NC=CS4)C(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/voreloxin.html |