Pyraclostrobin (Standard) | MedChemExpress (MCE)
Pyraclostrobin (Standard) is the analytical standard of Pyraclostrobin. This product is intended for research and analytical applications. Pyraclostrobin is a highly effective and broad-spectrum strobilurin fungicide. Pyraclostrobin can induce oxidative DNA damage, mitochondrial dysfunction and autophagy through the activation of AMPK/mTOR signaling. Pyraclostrobin can be used to control crop diseases[1][2][3].
| Trivial name | Pyraclostrobin (Standard) |
| Catalog Number | HY-N6626R |
| Research Area | Metabolic Disease; Infection |
| CAS# | 175013-18-0 |
| Purity | ≥98.0% |
| SMILES | COC(N(C1=C(C=CC=C1)COC2=NN(C3=CC=C(Cl)C=C3)C=C2)OC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pyraclostrobin-standard.html |