Talnetant
Talnetant is a potent and selective NK3 receptor antagonist (ki=1.4 nM, hNK-3-CHO), and is 100-fold selective for the hNK-3 versus hNK-2 receptor, with no affinity for the hNK-1 at concentrations up to 100 μM.
| Trivial name | SB-223412 |
| Catalog Number | CSN13678 |
| Alternative Name(s) | SB-223412 |
| Research Area | Neurological Disease |
| Molecular Formula | C25H22N2O2 |
| CAS# | 174636-32-9 |
| Purity | ≥98% |
| SMILES | O=C(C1=C(O)C(C2=CC=CC=C2)=NC3=CC=CC=C13)N[C@H](C4=CC=CC=C4)CC |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/talnetant.html |