Riluzole (Rilutek) 10mM * 1mL in DMSO
Riluzole preferentially blocks TTX-sensitive sodium channels, which are associated with damaged neurons.This reduces influx of calcium ions and indirectly prevents stimulation of glutamate receptors.
| Trivial name | Riluzole (Rilutek) 10mM * 1mL in DMSO |
| Catalog Number | A10795-10mM-D |
| Alternative Name(s) | 6-(trifluoromethoxy)benzothiazol-2-amine |
| Molecular Formula | C8H5F3N2OS |
| CAS# | 1744-22-5 |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)SC(=N2)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/riluzole-rilutek.html |