DTPA-tetra (t-Bu ester) | MedChemExpress (MCE)
DTPA-tetra (t-Bu ester)is a bifunctional chelator (Bifunctional Chelator; BFC) and a macrocyclic DPTA derivative used for tumor pre-targeting. DTPA-tetra (t-Bu ester) can be used for conjugation of peptides and radionuclides.
| Trivial name | DTPA-tetra (t-Bu ester) |
| Catalog Number | HY-A0074 |
| Alternative Name(s) | tetra-tBu-DTPA |
| Research Area | Others |
| CAS# | 174267-71-1 |
| Purity | ≥99.0% |
| SMILES | O=C(CN(CCN(CC(OC(C)(C)C)=O)CC(OC(C)(C)C)=O)CCN(CC(OC(C)(C)C)=O)CC(OC(C)(C)C)=O)O |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/dtpa-tetra-t-bu-ester.html |