Raloxifene D4 6 Glucuronide
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-30517 |
| Alternative Name(s) | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[2-(4-hydroxyphenyl)-3-{4-[2-(piperidin-1-yl)(D4)ethoxy]benzoyl}-1-benzothiophen-6-yl]oxy}oxane-2-carboxylic acid |
| Research Area | Labeled glucuronide of Raloxifene, intended for use as an internal standard for the quantification of Raloxifene by GC- or LC-mass spectrometry. |
| Molecular Formula | C34H31D4NO10S |
| CAS# | 174264-50-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=C(OC([2H])([2H])C([2H])([2H])N2CCCCC2)C=C1)C3=C(C4=CC=C(O)C=C4)SC5=C3C=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]6O)O)O[C@@H]6C(O)=O)=C5 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30517.html |
| Additional Information | NULL |