PHGDH-IN-5 | MedChemExpress (MCE)
PHGDH-IN-5 (Compound B12) is a covalen inhibitor of PHGDH with an IC50 value of 0.29 μM. PHGDH-IN-5 can inhibit cell proliferation in cancer cell lines overexpressing PHGDH. PHGDH-IN-5 can reduce the production of serine derived from glucose in MDA-MB-468 cells[1].
| Trivial name | PHGDH-IN-5 |
| Catalog Number | HY-161456 |
| Research Area | Cancer |
| CAS# | 17402-86-7 |
| Purity | ≥98.0% |
| SMILES | O=S1(C2=CC=CC([N+]([O-])=O)=C2C=C1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/phgdh-in-5.html |