Tanshinone IIB
Tanshinone IIB (TSB), a natural product isolated and purified from the roots of Salvia miltiorrhiza, can significantly inhibit the DNA laddering, cytotoxicity and apoptosis of rat cortical neurons induced by staurosporine in a concentration-dependent manner. Tanshinone IIB showed inhibitory effect on PL(pro) with IC50 value of 10.7μM and less inhibitory effect on 3CLpro with IC50 value of 24.8μM.
| Trivial name | Tanshinone-IIB |
| Catalog Number | CSN12034 |
| Alternative Name(s) | Tanshinone-IIB |
| Research Area | Infection |
| Molecular Formula | C19H18O4 |
| CAS# | 17397-93-2 |
| Purity | ≥98% |
| SMILES | O=C(C1=C2C=CC3=C1CCC[C@@]3(CO)C)C(C4=C2OC=C4C)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tanshinone-iib.html |