TBB
TBB is a highly selective, ATP/GTP-competitive inhibitor of casein kinase-2 (CK2)with IC50s of 0.9 and 1.6 μM for rat liver and human recombinant CK2 respectively).
| Trivial name | NSC 231634 |
| Catalog Number | CSN19438 |
| Alternative Name(s) | NSC 231634 |
| Research Area | Cancer |
| Molecular Formula | C6HBr4N3 |
| CAS# | 17374-26-4 |
| Purity | ≥99% |
| SMILES | BrC1=C(NN=N2)C2=C(Br)C(Br)=C1Br |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tbb.html |