Kaempferol 7-O-neohesperidoside | MedChemExpress (MCE)
Kaempferol 7-O-neohesperidoside is a ?avonoid glycoside that can be isolated from Litchi chinensis. Kaempferol 7-O-neohesperidoside exhibits significant cytotoxic activity against A549, LAC, Hep-G2, and HeLa cell lines with IC50s of 0.53, 7.93, 0.020, and 0.051 μM, respectively[1].
| Trivial name | Kaempferol 7-O-neohesperidoside |
| Catalog Number | HY-N8954 |
| Research Area | Cancer |
| CAS# | 17353-03-6 |
| Purity | ≥98.00% |
| SMILES | O=C1C(C(OC(C(C=C2)=CC=C2O)=C1O)=CC(O[C@H](O[C@@H]3CO)[C@@H]([C@H]([C@@H]3O)O)O[C@@](O[C@H]4C)([H])[C@@H]([C@@H]([C@H]4O)O)O)=C5)=C5O |
| PubChem Chemical Structure ID | 5483905 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kaempferol-7-o-neohesperidoside.html |