Aliskiren hemifumarate 10mM * 1mL in DMSO
Aliskiren hemifumarate is a hemifumarate salt form of Aliskiren, which is a direct renin inhibitor approved for the treatment of essential hypertension.
Trivial name | Aliskiren hemifumarate 10mM * 1mL in DMSO |
Catalog Number | A11123-10mM-D |
Alternative Name(s) | (2S,4S,5S,7S)-5-Amino-N-(2-carbamoyl-2-methylpropyl)-4-hydroxy-2-isopropyl-7-[4-methoxy-3-(3-methoxypropoxy)benzyl]-8-methylnonanamide hemifumarate |
Molecular Formula | C30H53N3O6.1/2C4H4O4 |
CAS# | 173334-58-2 |
SMILES | CC(C)[C@@H](CC1=CC(=C(C=C1)OC)OCCCOC)C[C@@H]([C@H](C[C@@H](C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.CC(C)[C@@H](CC1=CC(=C(C=C1)OC)OCCCOC)C[C@@H]([C@H](C[C@@H](C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.C(=C/C(=O)O)C(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/aliskiren-hemifumarate.html |