TC-E 5003
TC-E 5003 (NSC 30176, Compound 2e) is a selective inhibitor of protein arginine methyltransferase 1 (PRMT1) with IC50 of 1.5 μM. TC-E 5003 modulates the lipopolysaccharide (LPS)-induced AP-1 and NF-κB signaling pathways and can possibly be further developed as an anti-inflammatory compound.
| Trivial name | NSC 30176 |
| Catalog Number | S0855 |
| Molecular Formula | C16H14Cl2N2O4S |
| CAS# | 17328-16-4 |
| SMILES | ClCC(=O)NC1=CC=C(C=C1)[S](=O)(=O)C2=CC=C(NC(=O)CCl)C=C2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/tc-e-5003.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0855-tc-e5003-chemical-structure.gif |