Methyl Nonadecanoate
Methyl nonadecanoate (Nonadecanoic Acid methyl ester) is a fatty acid methyl ester, which is less water soluble but more amenable for the formulation of nonadecanoate-containing diets and dietary supplements.
| Trivial name | Nonadecanoic Acid methyl ester |
| Catalog Number | S5833 |
| Molecular Formula | C14H11NO3 |
| CAS# | 1731-94-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1(C)C(=O)N=C2C3=CC=CC=C3C(=O)C(=C12)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/methyl-nonadecanoate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/methyl-nonadecanoate-chemical-structure-s5833.gif |
