PP2
PP2 is a ATP-competitive inhibitor of the Src family of protein tyrosine kinases. The IC50s for p56lck, p59fynT, Hck, Src are 4 nM, 5 nM, 5 nM, 100 nM, respectively.
| Trivial name | AG 1879; AGL-1879 |
| Catalog Number | CSN11759 |
| Alternative Name(s) | AG 1879; AGL-1879 |
| Research Area | Cancer |
| Molecular Formula | C15H16ClN5 |
| CAS# | 172889-27-9 |
| Purity | ≥99% |
| SMILES | CC(C)(C)N1N=C(C2=C1N=CN=C2N)C1=CC=C(Cl)C=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/pp2.html |
