PP1 10mg
PP1 is a potent inhibitor of Src-family tyrosine kinases. Inhibits p56lck and p59fynT (IC50 values are 5 and 6 nM respectively). Displays > 8000-fold selectivity over ZAP-70 and JAK2. Also moderately inhibits p38, CSK, PDGF receptors, RET-derived oncoproteins, c-Kit and Bcr-Abl
| Trivial name | PP1 10mg |
| Catalog Number | A12724-10 |
| Alternative Name(s) | 1-(1,1-Dimethylethyl)-1-(4-methylph?enyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Formula | C16H19N5 |
| CAS# | 172889-26-8 |
| SMILES | CC1=CC=C(C=C1)C2=NN(C3=C2C(=NC=N3)N)C(C)(C)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/pp1.html |
