Varespladib (LY315920)
Varespladib (LY315920) is a potent and selective human non-pancreatic secretory phospholipase A2 (hnsPLA) inhibitor with IC50 of 7 nM. Phase 3.
| Trivial name | N/A |
| Catalog Number | S1110 |
| Molecular Formula | C11H20O4 |
| CAS# | 172732-68-2 |
| Inchi | InChI=1S/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15) |
| Inchi Key | LWBHHRRTOZQPDM-UHFFFAOYSA-N |
| SMILES | C(CCCCC(=O)O)CCCCC(=O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/LY315920(Varespladib).html |
| Additional Information | https://file.selleck.cn/downloads/struct/LY315920-Varespladib-chemical-structure-S1110.gif |
