Danazol (Standard) | MedChemExpress (MCE)
Danazol (Standard) is the analytical standard of Danazol. This product is intended for research and analytical applications. Danazol is a derivative of the synthetic steroid Ethisterone, which inhibits gonadotropin production and has a certain weak androgenic effect. Danazol is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Trivial name | Danazol (Standard) |
Catalog Number | HY-B1029R |
Research Area | Endocrinology; Cancer |
CAS# | 17230-88-5 |
Purity | ≥98.0% |
SMILES | C#C[C@]1(O)CC[C@@]2([H])[C@]3([H])CCC4=CC5=C(C=NO5)C[C@]4(C)[C@@]3([H])CC[C@@]21C |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/danazol-standard.html |