Mepivacaine hydrochloride (Standard) | MedChemExpress (MCE)
Mepivacaine (hydrochloride) (Standard) is the analytical standard of Mepivacaine (hydrochloride). This product is intended for research and analytical applications. Mepivacaine hydrochloride binds to specific voltage-gated sodium ion channels in neuronal cell membranes, which inhibits both sodium influx and membrane depolarization[1][2].
| Trivial name | Mepivacaine hydrochloride (Standard) |
| Catalog Number | HY-B0517AR |
| Research Area | Neurological Disease |
| CAS# | 1722-62-9 |
| Purity | ≥98.0% |
| SMILES | O=C(C(CCCC1)N1C)NC(C(C)=CC=C2)=C2C.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mepivacaine-hydrochloride-standard.html |
