4-Nitro-L-Phenylalanine Methyl Ester Hydrochloride
4-Nitro-L-Phenylalanine Methyl Ester Hydrochloride, is an intermediate in the synthesis of various pharmaceutical compounds. It can be used for the preparation of Matijing-Su derivatives as potent anti-HBV agents.
| Catalog Number | CS-O-20029 |
| Alternative Name(s) | p-Nitrophenylalanine Methyl Ester Hy-(4-nitrophenyl)ethanaminiAmino-3-(4-nitrophenyl)propionic Acid Methyl Ester Hydrochloride; (S)-(+)-4-Nitrophenylalanine methyl ester hydrochloride;p-Nitrophenylalanine Methyl Ester Hy-(4-nitrophenyl)ethanaminiAmino-3-(4-nitrophenyl)propionc cid Methyl Ester Hydrchloride; Methyl (S)-2-Amino-3-(4-nitrophenyl)propanoate Hydrchloride; |
| Research Area | Intermediates |
| Molecular Formula | C10H1ClN2O4 |
| CAS# | 17193-40-7 |
| Purity | >98% |
| SMILES | N[C@H](C(OC)=O)CC1=CC=C([N+]([O-])=O)C=C1.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20029.html |
