Tryprostatin A
Tryprostatin-A, a natural product isolated and purified from Aspergillus fumigatus, is an indole alkaloid-based fungal products that inhibit mammalian cell cycle at the G2/M phase and an inhibitor of breast cancer resistance protein.
| Trivial name | Tryprostatin-A |
| Catalog Number | CSN15632 |
| Alternative Name(s) | Tryprostatin-A |
| Research Area | / |
| Molecular Formula | C22H27N3O3 |
| CAS# | 171864-80-5 |
| Purity | ≥98% |
| SMILES | O=C(N[C@H]1CC2=C(C/C=C(C)\C)NC3=C2C=CC(OC)=C3)[C@@](CCC4)([H])N4C1=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/tryprostatin-a.html |