Tadalafil
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02425 |
| Alternative Name(s) | (6R,12aR)-6-(1,3-Benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-methylpyrazino[1�,2�:1,6]pyrido[3,4-b]indole-1,4-dion51; Tildenafil; UK 336017;(6R-trans)-6-(1,3-benzodioxol-5-yl)- 2,3,6,7,12,12a-hexahydro-2-methyl-pyrazino [1', 2':1,6] pyrido[3,4-b]indole-1,4-dione |
| Research Area | Used for the treatment of erectile dysfunction. A phosphodiesterase 5 inhibitor. |
| Molecular Formula | C22H19N3O4 |
| CAS# | 171596-29-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CN1C)N2[C@H](C3=CC(OCO4)=C4C=C3)C(NC5=CC=CC=C65)=C6C[C@]2([H])C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02425.html |
| Additional Information | NULL |